C24H34Cl2N4O4 — CID 118235136
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,3-diaminopropanoylamino)propanoate;dihydrochloride (PubChem CID 118235136) has the molecular formula C24H34Cl2N4O4 and a molecular weight of 513.47 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,3-diaminopropanoylamino)propanoate;dihydrochloride.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,3-diaminopropanoylamino)propanoate;dihydrochloride |
|---|---|
| PubChem CID | 118235136 |
| Molecular Formula | C24H34Cl2N4O4 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,3-diaminopropanoylamino)propanoate;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)C(=O)NCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H32N4O4.2ClH/c25-17-21(26)24(31)27-15-14-23(30)32-28-22(29)16-20-12-10-19(11-13-20)9-5-4-8-18-6-2-1-3-7-18;;/h1-3,6-7,10-13,21H,4-5,8-9,14-17,25-26H2,(H,27,31)(H,28,29);2*1H |
| InChIKey | LKHFETVCHMFETO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|