C22H29ClN2O3 — CID 118235169
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-aminobutanoate;hydrochloride (PubChem CID 118235169) has the molecular formula C22H29ClN2O3 and a molecular weight of 404.94 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-aminobutanoate;hydrochloride.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-aminobutanoate;hydrochloride |
|---|---|
| PubChem CID | 118235169 |
| Molecular Formula | C22H29ClN2O3 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 4-aminobutanoate;hydrochloride |
| SMILES | Cl.NCCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N2O3.ClH/c23-16-6-11-22(26)27-24-21(25)17-20-14-12-19(13-15-20)10-5-4-9-18-7-2-1-3-8-18;/h1-3,7-8,12-15H,4-6,9-11,16-17,23H2,(H,24,25);1H |
| InChIKey | KZXLMYRARDVJCT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|