C27H35NO3 — CID 118235221
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-cyclohexylpropanoate (PubChem CID 118235221) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-cyclohexylpropanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 118235221 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-cyclohexylpropanoate |
| SMILES | O=C(Cc1ccc(CCCCc2ccccc2)cc1)NOC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C27H35NO3/c29-26(28-31-27(30)20-19-23-11-5-2-6-12-23)21-25-17-15-24(16-18-25)14-8-7-13-22-9-3-1-4-10-22/h1,3-4,9-10,15-18,23H,2,5-8,11-14,19-21H2,(H,28,29) |
| InChIKey | MXUHCBQMSMGJGO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|