C26H36N2O4 — CID 158279247
methane;[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (6S)-6-amino-5-oxoheptanoate (PubChem CID 158279247) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is methane;[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (6S)-6-amino-5-oxoheptanoate.
| Compound Name | methane;[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (6S)-6-amino-5-oxoheptanoate |
|---|---|
| PubChem CID | 158279247 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | methane;[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (6S)-6-amino-5-oxoheptanoate |
| SMILES | C.C[C@H](N)C(=O)CCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H32N2O4.CH4/c1-19(26)23(28)12-7-13-25(30)31-27-24(29)18-22-16-14-21(15-17-22)11-6-5-10-20-8-3-2-4-9-20;/h2-4,8-9,14-17,19H,5-7,10-13,18,26H2,1H3,(H,27,29);1H4/t19-;/m0./s1 |
| InChIKey | GJZSZGYERONHQX-FYZYNONXSA-N |
| XLogP | 4.09 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|