C26H38Cl2N4O4 — CID 118235063
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,5-diaminopentanoyl]amino]propanoate;dihydrochloride (PubChem CID 118235063) has the molecular formula C26H38Cl2N4O4 and a molecular weight of 541.52 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,5-diaminopentanoyl]amino]propanoate;dihydrochloride.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,5-diaminopentanoyl]amino]propanoate;dihydrochloride |
|---|---|
| PubChem CID | 118235063 |
| Molecular Formula | C26H38Cl2N4O4 |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,5-diaminopentanoyl]amino]propanoate;dihydrochloride |
| SMILES | Cl.Cl.NCCC[C@H](N)C(=O)NCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H36N4O4.2ClH/c27-17-6-11-23(28)26(33)29-18-16-25(32)34-30-24(31)19-22-14-12-21(13-15-22)10-5-4-9-20-7-2-1-3-8-20;;/h1-3,7-8,12-15,23H,4-6,9-11,16-19,27-28H2,(H,29,33)(H,30,31);2*1H/t23-;;/m0../s1 |
| InChIKey | AZWQJCSPTFEHKP-IFUPQEAVSA-N |
| XLogP | 2.79 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|