C27H38N4O3 — CID 131743165
(2S)-2,6-diamino-N-[3-oxo-3-[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino]propyl]hexanamide (PubChem CID 131743165) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[3-oxo-3-[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino]propyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[3-oxo-3-[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino]propyl]hexanamide |
|---|---|
| PubChem CID | 131743165 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (2S)-2,6-diamino-N-[3-oxo-3-[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino]propyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NCCC(=O)NC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H38N4O3/c28-18-7-6-12-24(29)27(34)30-19-17-25(32)31-26(33)20-23-15-13-22(14-16-23)11-5-4-10-21-8-2-1-3-9-21/h1-3,8-9,13-16,24H,4-7,10-12,17-20,28-29H2,(H,30,34)(H,31,32,33)/t24-/m0/s1 |
| InChIKey | ZTUGCDLLNJTABO-DEOSSOPVSA-N |
| XLogP | 2.40 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|