C24H32N2O3 — CID 118235237
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 6-aminohexanoate (PubChem CID 118235237) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 6-aminohexanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 6-aminohexanoate |
|---|---|
| PubChem CID | 118235237 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 6-aminohexanoate |
| SMILES | NCCCCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H32N2O3/c25-18-8-2-5-13-24(28)29-26-23(27)19-22-16-14-21(15-17-22)12-7-6-11-20-9-3-1-4-10-20/h1,3-4,9-10,14-17H,2,5-8,11-13,18-19,25H2,(H,26,27) |
| InChIKey | DJQILTWGDGODLR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|