C23H28N2O4 — CID 11589333
[(8-anilino-8-oxooctanoyl)amino] 3-phenylpropanoate (PubChem CID 11589333) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(8-anilino-8-oxooctanoyl)amino] 3-phenylpropanoate.
| Compound Name | [(8-anilino-8-oxooctanoyl)amino] 3-phenylpropanoate |
|---|---|
| PubChem CID | 11589333 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(8-anilino-8-oxooctanoyl)amino] 3-phenylpropanoate |
| SMILES | O=C(CCCCCCC(=O)Nc1ccccc1)NOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O4/c26-21(24-20-13-7-4-8-14-20)15-9-1-2-10-16-22(27)25-29-23(28)18-17-19-11-5-3-6-12-19/h3-8,11-14H,1-2,9-10,15-18H2,(H,24,26)(H,25,27) |
| InChIKey | RFYCRNBLBIKGBX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|