C34H46N4O8 — CID 66574923
bis[(8-anilino-8-oxooctanoyl)amino] hexanedioate (PubChem CID 66574923) has the molecular formula C34H46N4O8 and a molecular weight of 638.76 g/mol. Its IUPAC name is bis[(8-anilino-8-oxooctanoyl)amino] hexanedioate.
| Compound Name | bis[(8-anilino-8-oxooctanoyl)amino] hexanedioate |
|---|---|
| PubChem CID | 66574923 |
| Molecular Formula | C34H46N4O8 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | bis[(8-anilino-8-oxooctanoyl)amino] hexanedioate |
| SMILES | O=C(CCCCCCC(=O)Nc1ccccc1)NOC(=O)CCCCC(=O)ONC(=O)CCCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C34H46N4O8/c39-29(35-27-17-7-5-8-18-27)21-11-1-3-13-23-31(41)37-45-33(43)25-15-16-26-34(44)46-38-32(42)24-14-4-2-12-22-30(40)36-28-19-9-6-10-20-28/h5-10,17-20H,1-4,11-16,21-26H2,(H,35,39)(H,36,40)(H,37,41)(H,38,42) |
| InChIKey | NJSQGMADHBHJSQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|