C18H25N3O6 — CID 146370179
3-[[(8-anilino-8-oxooctanoyl)amino]oxycarbonylamino]propanoic acid (PubChem CID 146370179) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-[[(8-anilino-8-oxooctanoyl)amino]oxycarbonylamino]propanoic acid.
| Compound Name | 3-[[(8-anilino-8-oxooctanoyl)amino]oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 146370179 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-[[(8-anilino-8-oxooctanoyl)amino]oxycarbonylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)ONC(=O)CCCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H25N3O6/c22-15(20-14-8-4-3-5-9-14)10-6-1-2-7-11-16(23)21-27-18(26)19-13-12-17(24)25/h3-5,8-9H,1-2,6-7,10-13H2,(H,19,26)(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | NPAYWYRSHJWOEU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|