About (6-anilino-6-oxohexyl) acetate
(6-anilino-6-oxohexyl) acetate (PubChem CID 154158064) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is (6-anilino-6-oxohexyl) acetate.
Molecular Properties
| Compound Name | (6-anilino-6-oxohexyl) acetate |
| PubChem CID | 154158064 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (6-anilino-6-oxohexyl) acetate |
| SMILES | CC(=O)OCCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-12(16)18-11-7-3-6-10-14(17)15-13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-11H2,1H3,(H,15,17) |
| InChIKey | OJBKTVNXCACNIT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6-anilino-6-oxohexyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-anilino-6-oxohexyl) acetate?
The IUPAC name of (6-anilino-6-oxohexyl) acetate (CID 154158064) is (6-anilino-6-oxohexyl) acetate.
What is the SMILES notation for (6-anilino-6-oxohexyl) acetate?
The canonical SMILES for (6-anilino-6-oxohexyl) acetate is CC(=O)OCCCCCC(=O)Nc1ccccc1.
What is the InChIKey of (6-anilino-6-oxohexyl) acetate?
The InChIKey is OJBKTVNXCACNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-12(16)18-11-7-3-6-10-14(17)15-13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-11H2,1H3,(H,15,17).
What are the key properties of (6-anilino-6-oxohexyl) acetate?
(6-anilino-6-oxohexyl) acetate has a molecular weight of 249.31 g/mol, XLogP of 2.75, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-anilino-6-oxohexyl) acetate is sourced from PubChem (CID 154158064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).