C31H42N4O6 — CID 118235310
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,6-diacetamidohexanoyl]amino]propanoate (PubChem CID 118235310) has the molecular formula C31H42N4O6 and a molecular weight of 566.70 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,6-diacetamidohexanoyl]amino]propanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,6-diacetamidohexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 118235310 |
| Molecular Formula | C31H42N4O6 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,6-diacetamidohexanoyl]amino]propanoate |
| SMILES | CC(=O)NCCCC[C@H](NC(C)=O)C(=O)NCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H42N4O6/c1-23(36)32-20-9-8-14-28(34-24(2)37)31(40)33-21-19-30(39)41-35-29(38)22-27-17-15-26(16-18-27)13-7-6-12-25-10-4-3-5-11-25/h3-5,10-11,15-18,28H,6-9,12-14,19-22H2,1-2H3,(H,32,36)(H,33,40)(H,34,37)(H,35,38)/t28-/m0/s1 |
| InChIKey | FIEIEXXTLZGNBE-NDEPHWFRSA-N |
| XLogP | 2.69 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|