C39H58N4O10 — CID 118247686
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-6-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]propanoate (PubChem CID 118247686) has the molecular formula C39H58N4O10 and a molecular weight of 742.91 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-6-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]propanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-6-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 118247686 |
| Molecular Formula | C39H58N4O10 |
| Molecular Weight | 742.91 g/mol |
| Exact Mass | 742.42 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-6-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]propanoate |
| SMILES | COCCOCCOCC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)NCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C39H58N4O10/c1-39(2,3)52-38(48)42-33(16-10-11-22-40-35(45)29-51-27-26-50-25-24-49-4)37(47)41-23-21-36(46)53-43-34(44)28-32-19-17-31(18-20-32)15-9-8-14-30-12-6-5-7-13-30/h5-7,12-13,17-20,33H,8-11,14-16,21-29H2,1-4H3,(H,40,45)(H,41,47)(H,42,48)(H,43,44)/t33-/m0/s1 |
| InChIKey | FVLZGXBSKKHKMF-XIFFEERXSA-N |
| XLogP | 3.73 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.91 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|