C44H68N4O12 — CID 129062461
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-3-[[(2S)-2,6-bis[[2-[2-(2-ethoxyethoxy)ethoxy]acetyl]amino]hexanoyl]amino]-2-methylpropanoate (PubChem CID 129062461) has the molecular formula C44H68N4O12 and a molecular weight of 845.04 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-3-[[(2S)-2,6-bis[[2-[2-(2-ethoxyethoxy)ethoxy]acetyl]amino]hexanoyl]amino]-2-methylpropanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-3-[[(2S)-2,6-bis[[2-[2-(2-ethoxyethoxy)ethoxy]acetyl]amino]hexanoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 129062461 |
| Molecular Formula | C44H68N4O12 |
| Molecular Weight | 845.04 g/mol |
| Exact Mass | 844.48 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-3-[[(2S)-2,6-bis[[2-[2-(2-ethoxyethoxy)ethoxy]acetyl]amino]hexanoyl]amino]-2-methylpropanoate |
| SMILES | CCOCCOCCOCC(=O)NCCCC[C@H](NC(=O)COCCOCCOCC)C(=O)NC[C@H](C)C(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C44H68N4O12/c1-4-54-23-25-56-27-29-58-33-41(50)45-22-12-11-17-39(47-42(51)34-59-30-28-57-26-24-55-5-2)43(52)46-32-35(3)44(53)60-48-40(49)31-38-20-18-37(19-21-38)16-10-9-15-36-13-7-6-8-14-36/h6-8,13-14,18-21,35,39H,4-5,9-12,15-17,22-34H2,1-3H3,(H,45,50)(H,46,52)(H,47,51)(H,48,49)/t35-,39-/m0/s1 |
| InChIKey | BLWVHMALIXGDEJ-HMIRPBQQSA-N |
| XLogP | 3.03 |
| TPSA | 198.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.04 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|