C39H56N4O10 — CID 118235138
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-1-[(2S)-2,6-bis[[2-(2-methoxyethoxy)acetyl]amino]hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 118235138) has the molecular formula C39H56N4O10 and a molecular weight of 740.90 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-1-[(2S)-2,6-bis[[2-(2-methoxyethoxy)acetyl]amino]hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-1-[(2S)-2,6-bis[[2-(2-methoxyethoxy)acetyl]amino]hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118235138 |
| Molecular Formula | C39H56N4O10 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.40 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-1-[(2S)-2,6-bis[[2-(2-methoxyethoxy)acetyl]amino]hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | COCCOCC(=O)NCCCC[C@H](NC(=O)COCCOC)C(=O)N1CCC[C@H]1C(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C39H56N4O10/c1-49-23-25-51-28-36(45)40-21-9-8-15-33(41-37(46)29-52-26-24-50-2)38(47)43-22-10-16-34(43)39(48)53-42-35(44)27-32-19-17-31(18-20-32)14-7-6-13-30-11-4-3-5-12-30/h3-5,11-12,17-20,33-34H,6-10,13-16,21-29H2,1-2H3,(H,40,45)(H,41,46)(H,42,44)/t33-,34-/m0/s1 |
| InChIKey | LRHGRGNVIKEFFV-HEVIKAOCSA-N |
| XLogP | 2.46 |
| TPSA | 170.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.90 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|