C43H64N4O11 — CID 154241917
(2S)-1-[(2S)-2,6-bis[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]hexanoyl]-N-[2-[4-(4-phenylbutyl)phenyl]acetyl]pyrrolidine-2-carboxamide (PubChem CID 154241917) has the molecular formula C43H64N4O11 and a molecular weight of 813.00 g/mol. Its IUPAC name is (2S)-1-[(2S)-2,6-bis[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]hexanoyl]-N-[2-[4-(4-phenylbutyl)phenyl]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2,6-bis[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]hexanoyl]-N-[2-[4-(4-phenylbutyl)phenyl]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154241917 |
| Molecular Formula | C43H64N4O11 |
| Molecular Weight | 813.00 g/mol |
| Exact Mass | 812.46 |
| IUPAC Name | (2S)-1-[(2S)-2,6-bis[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]hexanoyl]-N-[2-[4-(4-phenylbutyl)phenyl]acetyl]pyrrolidine-2-carboxamide |
| SMILES | COCCOCCOCC(=O)NCCCC[C@H](NC(=O)COCCOCCOC)C(=O)N1CCC[C@H]1C(=O)NC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C43H64N4O11/c1-53-23-25-55-27-29-57-32-40(49)44-21-9-8-15-37(45-41(50)33-58-30-28-56-26-24-54-2)43(52)47-22-10-16-38(47)42(51)46-39(48)31-36-19-17-35(18-20-36)14-7-6-13-34-11-4-3-5-12-34/h3-5,11-12,17-20,37-38H,6-10,13-16,21-33H2,1-2H3,(H,44,49)(H,45,50)(H,46,48,51)/t37-,38-/m0/s1 |
| InChIKey | VVYZQHRMYIIWDS-UWXQCODUSA-N |
| XLogP | 2.56 |
| TPSA | 180.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.00 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|