C34H48BN3O6 — CID 58940073
(2S)-N-[4-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-1-[3-phenyl-2-(3-phenylpropanoylamino)propanoyl]pyrrolidine-2-carboxamide (PubChem CID 58940073) has the molecular formula C34H48BN3O6 and a molecular weight of 605.59 g/mol. Its IUPAC name is (2S)-N-[4-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-1-[3-phenyl-2-(3-phenylpropanoylamino)propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-1-[3-phenyl-2-(3-phenylpropanoylamino)propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58940073 |
| Molecular Formula | C34H48BN3O6 |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.36 |
| IUPAC Name | (2S)-N-[4-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-1-[3-phenyl-2-(3-phenylpropanoylamino)propanoyl]pyrrolidine-2-carboxamide |
| SMILES | COCCCC(NC(=O)[C@@H]1CCCN1C(=O)C(Cc1ccccc1)NC(=O)CCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C34H48BN3O6/c1-33(2)34(3,4)44-35(43-33)29(19-13-23-42-5)37-31(40)28-18-12-22-38(28)32(41)27(24-26-16-10-7-11-17-26)36-30(39)21-20-25-14-8-6-9-15-25/h6-11,14-17,27-29H,12-13,18-24H2,1-5H3,(H,36,39)(H,37,40)/t27?,28-,29?/m0/s1 |
| InChIKey | WZXJIDMEFDHPPL-VJPAEBCTSA-N |
| XLogP | 3.88 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|