C23H33BBr2N3O7- — CID 16740934
[(1R)-4,4-dibromo-1-[[(2S)-1-[(2S)-2-(5-oxopentanoylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]butyl]-trihydroxyboranuide (PubChem CID 16740934) has the molecular formula C23H33BBr2N3O7- and a molecular weight of 634.15 g/mol. Its IUPAC name is [(1R)-4,4-dibromo-1-[[(2S)-1-[(2S)-2-(5-oxopentanoylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]butyl]-trihydroxyboranuide.
| Compound Name | [(1R)-4,4-dibromo-1-[[(2S)-1-[(2S)-2-(5-oxopentanoylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]butyl]-trihydroxyboranuide |
|---|---|
| PubChem CID | 16740934 |
| Molecular Formula | C23H33BBr2N3O7- |
| Molecular Weight | 634.15 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | [(1R)-4,4-dibromo-1-[[(2S)-1-[(2S)-2-(5-oxopentanoylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]butyl]-trihydroxyboranuide |
| SMILES | O=CCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(Br)Br)[B-](O)(O)O |
| InChI | InChI=1S/C23H33BBr2N3O7/c25-20(26)12-11-19(24(34,35)36)28-22(32)18-9-6-13-29(18)23(33)17(15-16-7-2-1-3-8-16)27-21(31)10-4-5-14-30/h1-3,7-8,14,17-20,34-36H,4-6,9-13,15H2,(H,27,31)(H,28,32)/q-1/t17-,18-,19-/m0/s1 |
| InChIKey | COCQAHVKNPNLSI-FHWLQOOXSA-N |
| XLogP | 0.91 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|