C27H35BN3NaO7 — CID 162305049
sodium hydroxy-[(1R)-4-methoxy-1-[[1-[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]butyl]borinate (PubChem CID 162305049) has the molecular formula C27H35BN3NaO7 and a molecular weight of 547.39 g/mol. Its IUPAC name is sodium hydroxy-[(1R)-4-methoxy-1-[[1-[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]butyl]borinate.
| Compound Name | sodium hydroxy-[(1R)-4-methoxy-1-[[1-[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]butyl]borinate |
|---|---|
| PubChem CID | 162305049 |
| Molecular Formula | C27H35BN3NaO7 |
| Molecular Weight | 547.39 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | sodium hydroxy-[(1R)-4-methoxy-1-[[1-[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]butyl]borinate |
| SMILES | COCCC[C@H](NC(=O)C1CCCN1C(=O)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1)B([O-])O.[Na+] |
| InChI | InChI=1S/C27H35BN3O7.Na/c1-37-17-9-15-24(28(35)36)30-25(32)23-14-8-16-31(23)26(33)22(18-20-10-4-2-5-11-20)29-27(34)38-19-21-12-6-3-7-13-21;/h2-7,10-13,22-24,35H,8-9,14-19H2,1H3,(H,29,34)(H,30,32);/q-1;+1/t22-,23?,24+;/m1./s1 |
| InChIKey | DTBQQLRGQRNUCQ-HFCHKYIYSA-N |
| XLogP | -2.19 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.39 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|