C19H28N2O4S — CID 87037014
N-(3-benzylsulfonylpropyl)-1-(2-methylpropanoyl)pyrrolidine-2-carboxamide (PubChem CID 87037014) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-1-(2-methylpropanoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-1-(2-methylpropanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87037014 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-1-(2-methylpropanoyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(=O)N1CCCC1C(=O)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H28N2O4S/c1-15(2)19(23)21-12-6-10-17(21)18(22)20-11-7-13-26(24,25)14-16-8-4-3-5-9-16/h3-5,8-9,15,17H,6-7,10-14H2,1-2H3,(H,20,22) |
| InChIKey | JYPFAWFPBSGJHP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|