C23H36N4O4 — CID 70059423
tert-butyl N-[4-[[(2S)-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]butyl]carbamate (PubChem CID 70059423) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2S)-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2S)-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 70059423 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | tert-butyl N-[4-[[(2S)-1-[(2R)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=O)[C@@H]1CCCN1C(=O)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C23H36N4O4/c1-23(2,3)31-22(30)26-14-8-7-13-25-20(28)19-12-9-15-27(19)21(29)18(24)16-17-10-5-4-6-11-17/h4-6,10-11,18-19H,7-9,12-16,24H2,1-3H3,(H,25,28)(H,26,30)/t18-,19+/m1/s1 |
| InChIKey | GAEJKYJPGYHKII-MOPGFXCFSA-N |
| XLogP | 1.97 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|