C22H28N2O3S — CID 101173677
(2S)-1-benzylsulfonyl-N-(3-phenylpropyl)piperidine-2-carboxamide (PubChem CID 101173677) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is (2S)-1-benzylsulfonyl-N-(3-phenylpropyl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-benzylsulfonyl-N-(3-phenylpropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 101173677 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (2S)-1-benzylsulfonyl-N-(3-phenylpropyl)piperidine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@@H]1CCCCN1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O3S/c25-22(23-16-9-14-19-10-3-1-4-11-19)21-15-7-8-17-24(21)28(26,27)18-20-12-5-2-6-13-20/h1-6,10-13,21H,7-9,14-18H2,(H,23,25)/t21-/m0/s1 |
| InChIKey | DZENBVRGYXXQPW-NRFANRHFSA-N |
| XLogP | 3.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|