C17H27N3O3S — CID 78781172
1-(benzenesulfonyl)-N-[3-(dimethylamino)propyl]piperidine-2-carboxamide (PubChem CID 78781172) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[3-(dimethylamino)propyl]piperidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[3-(dimethylamino)propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78781172 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[3-(dimethylamino)propyl]piperidine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H27N3O3S/c1-19(2)13-8-12-18-17(21)16-11-6-7-14-20(16)24(22,23)15-9-4-3-5-10-15/h3-5,9-10,16H,6-8,11-14H2,1-2H3,(H,18,21) |
| InChIKey | PLLRQDKQAOHASY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|