C16H22N2O5S2 — CID 171136980
1-(benzenesulfonyl)-N-(3-methylsulfonylprop-2-enyl)piperidine-2-carboxamide (PubChem CID 171136980) has the molecular formula C16H22N2O5S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(3-methylsulfonylprop-2-enyl)piperidine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(3-methylsulfonylprop-2-enyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 171136980 |
| Molecular Formula | C16H22N2O5S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(3-methylsulfonylprop-2-enyl)piperidine-2-carboxamide |
| SMILES | CS(=O)(=O)C=CCNC(=O)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O5S2/c1-24(20,21)13-7-11-17-16(19)15-10-5-6-12-18(15)25(22,23)14-8-3-2-4-9-14/h2-4,7-9,13,15H,5-6,10-12H2,1H3,(H,17,19) |
| InChIKey | XLZLFRPOQXSLQF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |