C20H31N3O3 — CID 141226060
(2S)-1-[(2S)-6-amino-2-[deuterio(3-phenylpropyl)amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 141226060) has the molecular formula C20H31N3O3 and a molecular weight of 362.49 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[deuterio(3-phenylpropyl)amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[deuterio(3-phenylpropyl)amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141226060 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[deuterio(3-phenylpropyl)amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | [2H]N(CCCc1ccccc1)[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C20H31N3O3/c21-13-5-4-11-17(19(24)23-15-7-12-18(23)20(25)26)22-14-6-10-16-8-2-1-3-9-16/h1-3,8-9,17-18,22H,4-7,10-15,21H2,(H,25,26)/t17-,18-/m0/s1/i/hD |
| InChIKey | LMBZIVLOZXQBLI-OPJAUPJWSA-N |
| XLogP | 1.78 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|