C21H30FN3O5 — CID 70876164
(2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-(4-fluorophenyl)propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 70876164) has the molecular formula C21H30FN3O5 and a molecular weight of 423.49 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-(4-fluorophenyl)propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-(4-fluorophenyl)propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70876164 |
| Molecular Formula | C21H30FN3O5 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-(4-fluorophenyl)propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](N[C@@H](CCc1ccc(F)cc1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H30FN3O5/c22-15-9-6-14(7-10-15)8-11-17(20(27)28)24-16(4-1-2-12-23)19(26)25-13-3-5-18(25)21(29)30/h6-7,9-10,16-18,24H,1-5,8,11-13,23H2,(H,27,28)(H,29,30)/t16-,17-,18-/m0/s1 |
| InChIKey | HXAWWPMJIYJFQV-BZSNNMDCSA-N |
| XLogP | 1.37 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|