C22H37N3O4 — CID 143094632
1-[6-amino-2-(4-phenylbutan-2-ylamino)hexanoyl]pyrrolidine-2-carboxylic acid;methanol (PubChem CID 143094632) has the molecular formula C22H37N3O4 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[6-amino-2-(4-phenylbutan-2-ylamino)hexanoyl]pyrrolidine-2-carboxylic acid;methanol.
| Compound Name | 1-[6-amino-2-(4-phenylbutan-2-ylamino)hexanoyl]pyrrolidine-2-carboxylic acid;methanol |
|---|---|
| PubChem CID | 143094632 |
| Molecular Formula | C22H37N3O4 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 1-[6-amino-2-(4-phenylbutan-2-ylamino)hexanoyl]pyrrolidine-2-carboxylic acid;methanol |
| SMILES | CC(CCc1ccccc1)NC(CCCCN)C(=O)N1CCCC1C(=O)O.CO |
| InChI | InChI=1S/C21H33N3O3.CH4O/c1-16(12-13-17-8-3-2-4-9-17)23-18(10-5-6-14-22)20(25)24-15-7-11-19(24)21(26)27;1-2/h2-4,8-9,16,18-19,23H,5-7,10-15,22H2,1H3,(H,26,27);2H,1H3 |
| InChIKey | MNQDDYURSOZTKW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|