C19H28N2O3 — CID 58641902
1-[2-(4-phenylbutan-2-ylamino)propanoyl]piperidine-2-carboxylic acid (PubChem CID 58641902) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[2-(4-phenylbutan-2-ylamino)propanoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(4-phenylbutan-2-ylamino)propanoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58641902 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[2-(4-phenylbutan-2-ylamino)propanoyl]piperidine-2-carboxylic acid |
| SMILES | CC(CCc1ccccc1)NC(C)C(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C19H28N2O3/c1-14(11-12-16-8-4-3-5-9-16)20-15(2)18(22)21-13-7-6-10-17(21)19(23)24/h3-5,8-9,14-15,17,20H,6-7,10-13H2,1-2H3,(H,23,24) |
| InChIKey | FWPDLAPOYFCFGB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |