C21H32N3NaO5 — CID 132936622
sodium;(2R)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-(2,3,4,5,6-pentadeuteriophenyl)propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid;hydride (PubChem CID 132936622) has the molecular formula C21H32N3NaO5 and a molecular weight of 434.52 g/mol. Its IUPAC name is sodium;(2R)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-(2,3,4,5,6-pentadeuteriophenyl)propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid;hydride.
| Compound Name | sodium;(2R)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-(2,3,4,5,6-pentadeuteriophenyl)propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid;hydride |
|---|---|
| PubChem CID | 132936622 |
| Molecular Formula | C21H32N3NaO5 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | sodium;(2R)-1-[(2S)-6-amino-2-[[(1R)-1-carboxy-3-(2,3,4,5,6-pentadeuteriophenyl)propyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid;hydride |
| SMILES | [2H]c1c([2H])c([2H])c(CC[C@@H](N[C@@H](CCCCN)C(=O)N2CCC[C@@H]2C(=O)O)C(=O)O)c([2H])c1[2H].[H-].[Na+] |
| InChI | InChI=1S/C21H31N3O5.Na.H/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15;;/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29);;/q;+1;-1/t16-,17+,18+;;/m0../s1/i1D,2D,3D,7D,8D;; |
| InChIKey | XGHFVSPIBGFVMZ-NVCYBWEVSA-N |
| XLogP | -1.65 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|