C19H35N3O5 — CID 15927715
(2S)-1-[(2S)-2-[[(1R)-10-amino-1-carboxydecyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 15927715) has the molecular formula C19H35N3O5 and a molecular weight of 385.51 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(1R)-10-amino-1-carboxydecyl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(1R)-10-amino-1-carboxydecyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 15927715 |
| Molecular Formula | C19H35N3O5 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(1R)-10-amino-1-carboxydecyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](N[C@H](CCCCCCCCCN)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C19H35N3O5/c1-14(17(23)22-13-9-11-16(22)19(26)27)21-15(18(24)25)10-7-5-3-2-4-6-8-12-20/h14-16,21H,2-13,20H2,1H3,(H,24,25)(H,26,27)/t14-,15+,16-/m0/s1 |
| InChIKey | VNKQEVZONOYKBK-XHSDSOJGSA-N |
| XLogP | 1.57 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|