C11H21N3O2 — CID 104683570
1-(5-amino-2-methylpentanoyl)pyrrolidine-2-carboxamide (PubChem CID 104683570) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-(5-amino-2-methylpentanoyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(5-amino-2-methylpentanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 104683570 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 1-(5-amino-2-methylpentanoyl)pyrrolidine-2-carboxamide |
| SMILES | CC(CCCN)C(=O)N1CCCC1C(N)=O |
| InChI | InChI=1S/C11H21N3O2/c1-8(4-2-6-12)11(16)14-7-3-5-9(14)10(13)15/h8-9H,2-7,12H2,1H3,(H2,13,15) |
| InChIKey | WYUAYLNMNPXWCO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |