C22H31N3O7 — CID 22822724
(2S)-1-[2-[[(1S)-1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 22822724) has the molecular formula C22H31N3O7 and a molecular weight of 449.50 g/mol. Its IUPAC name is (2S)-1-[2-[[(1S)-1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[[(1S)-1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22822724 |
| Molecular Formula | C22H31N3O7 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (2S)-1-[2-[[(1S)-1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C22H31N3O7/c1-15(19(26)25-13-7-11-18(25)21(29)30)24-17(20(27)28)10-5-6-12-23-22(31)32-14-16-8-3-2-4-9-16/h2-4,8-9,15,17-18,24H,5-7,10-14H2,1H3,(H,23,31)(H,27,28)(H,29,30)/t15?,17-,18-/m0/s1 |
| InChIKey | ZXHGKFHNNGXVAB-BEEDKBRMSA-N |
| XLogP | 1.59 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|