C23H32N4O7 — CID 21273928
3-[[1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazine-6-carboxylic acid (PubChem CID 21273928) has the molecular formula C23H32N4O7 and a molecular weight of 476.53 g/mol. Its IUPAC name is 3-[[1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazine-6-carboxylic acid.
| Compound Name | 3-[[1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazine-6-carboxylic acid |
|---|---|
| PubChem CID | 21273928 |
| Molecular Formula | C23H32N4O7 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 3-[[1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]amino]-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazine-6-carboxylic acid |
| SMILES | O=C(NCCCCC(NC1CCN2CCCC(C(=O)O)N2C1=O)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C23H32N4O7/c28-20-17(11-14-26-13-6-10-19(22(31)32)27(20)26)25-18(21(29)30)9-4-5-12-24-23(33)34-15-16-7-2-1-3-8-16/h1-3,7-8,17-19,25H,4-6,9-15H2,(H,24,33)(H,29,30)(H,31,32) |
| InChIKey | KQLYPFHFKVBBQQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 148.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|