C24H34N4O6 — CID 21273916
3-[[1-carboxy-5-(3-phenylpropanoylamino)pentyl]amino]-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazine-6-carboxylic acid (PubChem CID 21273916) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-[[1-carboxy-5-(3-phenylpropanoylamino)pentyl]amino]-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazine-6-carboxylic acid.
| Compound Name | 3-[[1-carboxy-5-(3-phenylpropanoylamino)pentyl]amino]-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazine-6-carboxylic acid |
|---|---|
| PubChem CID | 21273916 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 3-[[1-carboxy-5-(3-phenylpropanoylamino)pentyl]amino]-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazine-6-carboxylic acid |
| SMILES | O=C(CCc1ccccc1)NCCCCC(NC1CCN2CCCC(C(=O)O)N2C1=O)C(=O)O |
| InChI | InChI=1S/C24H34N4O6/c29-21(12-11-17-7-2-1-3-8-17)25-14-5-4-9-19(23(31)32)26-18-13-16-27-15-6-10-20(24(33)34)28(27)22(18)30/h1-3,7-8,18-20,26H,4-6,9-16H2,(H,25,29)(H,31,32)(H,33,34) |
| InChIKey | BVQFDWDIAUCMLP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|