C21H27N3O6 — CID 13341498
3-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-1,4-dioxo-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxylic acid (PubChem CID 13341498) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is 3-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-1,4-dioxo-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxylic acid.
| Compound Name | 3-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-1,4-dioxo-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxylic acid |
|---|---|
| PubChem CID | 13341498 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-1,4-dioxo-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxylic acid |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC1CC(=O)N2CCCC(C(=O)O)N2C1=O |
| InChI | InChI=1S/C21H27N3O6/c1-2-30-21(29)15(11-10-14-7-4-3-5-8-14)22-16-13-18(25)23-12-6-9-17(20(27)28)24(23)19(16)26/h3-5,7-8,15-17,22H,2,6,9-13H2,1H3,(H,27,28) |
| InChIKey | KQRKCIXAMASMDA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |