C26H37N3O6 — CID 13341508
tert-butyl 7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 13341508) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is tert-butyl 7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | tert-butyl 7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 13341508 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | tert-butyl 7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC1CCC(=O)N2CCCC(C(=O)OC(C)(C)C)N2C1=O |
| InChI | InChI=1S/C26H37N3O6/c1-5-34-24(32)20(14-13-18-10-7-6-8-11-18)27-19-15-16-22(30)28-17-9-12-21(29(28)23(19)31)25(33)35-26(2,3)4/h6-8,10-11,19-21,27H,5,9,12-17H2,1-4H3 |
| InChIKey | AIJKQCBXVNQYMB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |