C23H39N3O6 — CID 70393484
tert-butyl (4S,7S)-7-[[(2R)-1-ethoxy-5-methyl-1-oxohexan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 70393484) has the molecular formula C23H39N3O6 and a molecular weight of 453.58 g/mol. Its IUPAC name is tert-butyl (4S,7S)-7-[[(2R)-1-ethoxy-5-methyl-1-oxohexan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | tert-butyl (4S,7S)-7-[[(2R)-1-ethoxy-5-methyl-1-oxohexan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 70393484 |
| Molecular Formula | C23H39N3O6 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | tert-butyl (4S,7S)-7-[[(2R)-1-ethoxy-5-methyl-1-oxohexan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H](CCC(C)C)N[C@H]1CCC(=O)N2CCC[C@@H](C(=O)OC(C)(C)C)N2C1=O |
| InChI | InChI=1S/C23H39N3O6/c1-7-31-21(29)17(11-10-15(2)3)24-16-12-13-19(27)25-14-8-9-18(26(25)20(16)28)22(30)32-23(4,5)6/h15-18,24H,7-14H2,1-6H3/t16-,17+,18-/m0/s1 |
| InChIKey | BFWLZIWNLCSHGP-KSZLIROESA-N |
| XLogP | 2.18 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |