C24H28N4O5 — CID 11270921
tert-butyl 7-(isoquinoline-1-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 11270921) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is tert-butyl 7-(isoquinoline-1-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | tert-butyl 7-(isoquinoline-1-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 11270921 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | tert-butyl 7-(isoquinoline-1-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCN2C(=O)CCC(NC(=O)c3nccc4ccccc34)C(=O)N12 |
| InChI | InChI=1S/C24H28N4O5/c1-24(2,3)33-23(32)18-9-6-14-27-19(29)11-10-17(22(31)28(18)27)26-21(30)20-16-8-5-4-7-15(16)12-13-25-20/h4-5,7-8,12-13,17-18H,6,9-11,14H2,1-3H3,(H,26,30) |
| InChIKey | PQCNNGNWPHIQIW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |