C25H33N3O6S — CID 57036772
tert-butyl (4R,7R)-7-[[(2R)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 57036772) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is tert-butyl (4R,7R)-7-[[(2R)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | tert-butyl (4R,7R)-7-[[(2R)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 57036772 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | tert-butyl (4R,7R)-7-[[(2R)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | CC(=O)S[C@H](Cc1ccccc1)C(=O)N[C@@H]1CCC(=O)N2CCC[C@H](C(=O)OC(C)(C)C)N2C1=O |
| InChI | InChI=1S/C25H33N3O6S/c1-16(29)35-20(15-17-9-6-5-7-10-17)22(31)26-18-12-13-21(30)27-14-8-11-19(28(27)23(18)32)24(33)34-25(2,3)4/h5-7,9-10,18-20H,8,11-15H2,1-4H3,(H,26,31)/t18-,19-,20-/m1/s1 |
| InChIKey | YUZWJIJTGSZIFJ-VAMGGRTRSA-N |
| XLogP | 2.23 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|