C19H25N3O5S — CID 56994777
2-[(6S)-6-[[(2R)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-2-methyl-7-oxodiazepan-1-yl]acetic acid (PubChem CID 56994777) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-[(6S)-6-[[(2R)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-2-methyl-7-oxodiazepan-1-yl]acetic acid.
| Compound Name | 2-[(6S)-6-[[(2R)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-2-methyl-7-oxodiazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 56994777 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[(6S)-6-[[(2R)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-2-methyl-7-oxodiazepan-1-yl]acetic acid |
| SMILES | CC(=O)S[C@H](Cc1ccccc1)C(=O)N[C@H]1CCCN(C)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C19H25N3O5S/c1-13(23)28-16(11-14-7-4-3-5-8-14)18(26)20-15-9-6-10-21(2)22(19(15)27)12-17(24)25/h3-5,7-8,15-16H,6,9-12H2,1-2H3,(H,20,26)(H,24,25)/t15-,16+/m0/s1 |
| InChIKey | USBCEQSGOBEDHR-JKSUJKDBSA-N |
| XLogP | 0.92 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|