C24H26N2O5S2 — CID 54559604
2-[6-[(2-acetylsulfanyl-3-phenylpropanoyl)amino]-5-oxo-2-phenyl-1,4-thiazepan-4-yl]acetic acid (PubChem CID 54559604) has the molecular formula C24H26N2O5S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[6-[(2-acetylsulfanyl-3-phenylpropanoyl)amino]-5-oxo-2-phenyl-1,4-thiazepan-4-yl]acetic acid.
| Compound Name | 2-[6-[(2-acetylsulfanyl-3-phenylpropanoyl)amino]-5-oxo-2-phenyl-1,4-thiazepan-4-yl]acetic acid |
|---|---|
| PubChem CID | 54559604 |
| Molecular Formula | C24H26N2O5S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-[6-[(2-acetylsulfanyl-3-phenylpropanoyl)amino]-5-oxo-2-phenyl-1,4-thiazepan-4-yl]acetic acid |
| SMILES | CC(=O)SC(Cc1ccccc1)C(=O)NC1CSC(c2ccccc2)CN(CC(=O)O)C1=O |
| InChI | InChI=1S/C24H26N2O5S2/c1-16(27)33-20(12-17-8-4-2-5-9-17)23(30)25-19-15-32-21(18-10-6-3-7-11-18)13-26(24(19)31)14-22(28)29/h2-11,19-21H,12-15H2,1H3,(H,25,30)(H,28,29) |
| InChIKey | ZPPLUOKAAOCDIK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|