C28H26N2O5S — CID 139631503
2-[3-[(2-benzoylsulfanyl-3-phenylpropanoyl)amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid (PubChem CID 139631503) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is 2-[3-[(2-benzoylsulfanyl-3-phenylpropanoyl)amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid.
| Compound Name | 2-[3-[(2-benzoylsulfanyl-3-phenylpropanoyl)amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid |
|---|---|
| PubChem CID | 139631503 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[3-[(2-benzoylsulfanyl-3-phenylpropanoyl)amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(NC(=O)C(Cc2ccccc2)SC(=O)c2ccccc2)CCc2ccccc21 |
| InChI | InChI=1S/C28H26N2O5S/c31-25(32)18-30-23-14-8-7-11-20(23)15-16-22(27(30)34)29-26(33)24(17-19-9-3-1-4-10-19)36-28(35)21-12-5-2-6-13-21/h1-14,22,24H,15-18H2,(H,29,33)(H,31,32) |
| InChIKey | XJGUNGCSHIPANN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|