C24H26N2O5S — CID 54211043
2-[3-[(2-acetylsulfanyl-3-phenylpropanoyl)amino]-2-oxo-3,4,5,6-tetrahydro-1-benzazocin-1-yl]acetic acid (PubChem CID 54211043) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-[3-[(2-acetylsulfanyl-3-phenylpropanoyl)amino]-2-oxo-3,4,5,6-tetrahydro-1-benzazocin-1-yl]acetic acid.
| Compound Name | 2-[3-[(2-acetylsulfanyl-3-phenylpropanoyl)amino]-2-oxo-3,4,5,6-tetrahydro-1-benzazocin-1-yl]acetic acid |
|---|---|
| PubChem CID | 54211043 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-[3-[(2-acetylsulfanyl-3-phenylpropanoyl)amino]-2-oxo-3,4,5,6-tetrahydro-1-benzazocin-1-yl]acetic acid |
| SMILES | CC(=O)SC(Cc1ccccc1)C(=O)NC1CCCc2ccccc2N(CC(=O)O)C1=O |
| InChI | InChI=1S/C24H26N2O5S/c1-16(27)32-21(14-17-8-3-2-4-9-17)23(30)25-19-12-7-11-18-10-5-6-13-20(18)26(24(19)31)15-22(28)29/h2-6,8-10,13,19,21H,7,11-12,14-15H2,1H3,(H,25,30)(H,28,29) |
| InChIKey | PVYXHZJKRGHGLZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|