C23H32N2O5S — CID 10503649
methyl 2-[(3S,7S)-3-[[(2S)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-2-oxo-7-propylazepan-1-yl]acetate (PubChem CID 10503649) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is methyl 2-[(3S,7S)-3-[[(2S)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-2-oxo-7-propylazepan-1-yl]acetate.
| Compound Name | methyl 2-[(3S,7S)-3-[[(2S)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-2-oxo-7-propylazepan-1-yl]acetate |
|---|---|
| PubChem CID | 10503649 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | methyl 2-[(3S,7S)-3-[[(2S)-2-acetylsulfanyl-3-phenylpropanoyl]amino]-2-oxo-7-propylazepan-1-yl]acetate |
| SMILES | CCC[C@H]1CCC[C@H](NC(=O)[C@H](Cc2ccccc2)SC(C)=O)C(=O)N1CC(=O)OC |
| InChI | InChI=1S/C23H32N2O5S/c1-4-9-18-12-8-13-19(23(29)25(18)15-21(27)30-3)24-22(28)20(31-16(2)26)14-17-10-6-5-7-11-17/h5-7,10-11,18-20H,4,8-9,12-15H2,1-3H3,(H,24,28)/t18-,19-,20-/m0/s1 |
| InChIKey | MEWGUQCXZHAGIW-UFYCRDLUSA-N |
| XLogP | 2.72 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|