C21H28N2O4S — CID 57175576
2-[(3R,7S)-7-(cyclopropylmethyl)-2-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]acetic acid (PubChem CID 57175576) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 2-[(3R,7S)-7-(cyclopropylmethyl)-2-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]acetic acid.
| Compound Name | 2-[(3R,7S)-7-(cyclopropylmethyl)-2-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 57175576 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[(3R,7S)-7-(cyclopropylmethyl)-2-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)[C@H](NC(=O)[C@H](S)Cc2ccccc2)CCC[C@H]1CC1CC1 |
| InChI | InChI=1S/C21H28N2O4S/c24-19(25)13-23-16(11-15-9-10-15)7-4-8-17(21(23)27)22-20(26)18(28)12-14-5-2-1-3-6-14/h1-3,5-6,15-18,28H,4,7-13H2,(H,22,26)(H,24,25)/t16-,17+,18+/m0/s1 |
| InChIKey | VEDUWGNJXRLFHV-RCCFBDPRSA-N |
| XLogP | 2.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|