C18H22N2O4S2 — CID 56627692
(4S,7S,9aS)-5-oxo-4-[(3-phenyl-2-sulfanylpropanoyl)amino]-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid (PubChem CID 56627692) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (4S,7S,9aS)-5-oxo-4-[(3-phenyl-2-sulfanylpropanoyl)amino]-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid.
| Compound Name | (4S,7S,9aS)-5-oxo-4-[(3-phenyl-2-sulfanylpropanoyl)amino]-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid |
|---|---|
| PubChem CID | 56627692 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (4S,7S,9aS)-5-oxo-4-[(3-phenyl-2-sulfanylpropanoyl)amino]-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]thiazepine-7-carboxylic acid |
| SMILES | O=C(N[C@H]1CCS[C@H]2CC[C@@H](C(=O)O)N2C1=O)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O4S2/c21-16(14(25)10-11-4-2-1-3-5-11)19-12-8-9-26-15-7-6-13(18(23)24)20(15)17(12)22/h1-5,12-15,25H,6-10H2,(H,19,21)(H,23,24)/t12-,13-,14?,15-/m0/s1 |
| InChIKey | NXSFASPBRGQMMG-NZATWWQASA-N |
| XLogP | 1.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|