C38H50N4O4S2 — CID 86706247
(2R,5R)-N,N'-bis[(4S,10aS)-5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl]-2,5-dibenzylhexanediamide (PubChem CID 86706247) has the molecular formula C38H50N4O4S2 and a molecular weight of 690.98 g/mol. Its IUPAC name is (2R,5R)-N,N'-bis[(4S,10aS)-5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl]-2,5-dibenzylhexanediamide.
| Compound Name | (2R,5R)-N,N'-bis[(4S,10aS)-5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl]-2,5-dibenzylhexanediamide |
|---|---|
| PubChem CID | 86706247 |
| Molecular Formula | C38H50N4O4S2 |
| Molecular Weight | 690.98 g/mol |
| Exact Mass | 690.33 |
| IUPAC Name | (2R,5R)-N,N'-bis[(4S,10aS)-5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl]-2,5-dibenzylhexanediamide |
| SMILES | O=C(N[C@H]1CCS[C@H]2CCCCN2C1=O)[C@H](CC[C@H](Cc1ccccc1)C(=O)N[C@H]1CCS[C@H]2CCCCN2C1=O)Cc1ccccc1 |
| InChI | InChI=1S/C38H50N4O4S2/c43-35(39-31-19-23-47-33-15-7-9-21-41(33)37(31)45)29(25-27-11-3-1-4-12-27)17-18-30(26-28-13-5-2-6-14-28)36(44)40-32-20-24-48-34-16-8-10-22-42(34)38(32)46/h1-6,11-14,29-34H,7-10,15-26H2,(H,39,43)(H,40,44)/t29-,30-,31+,32+,33+,34+/m1/s1 |
| InChIKey | NDWRFBYIMKZJCZ-ZRBWWFCKSA-N |
| XLogP | 5.41 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |