C17H22N2O3S — CID 77475000
benzyl N-(5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl)carbamate (PubChem CID 77475000) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is benzyl N-(5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl)carbamate.
| Compound Name | benzyl N-(5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl)carbamate |
|---|---|
| PubChem CID | 77475000 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | benzyl N-(5-oxo-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepin-4-yl)carbamate |
| SMILES | O=C(NC1CCSC2CCCCN2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O3S/c20-16-14(9-11-23-15-8-4-5-10-19(15)16)18-17(21)22-12-13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-12H2,(H,18,21) |
| InChIKey | RQHZOMAQHCXEDT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |