C11H13N3O3 — CID 13132707
benzyl N-[(3S)-1-amino-2-oxoazetidin-3-yl]carbamate (PubChem CID 13132707) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is benzyl N-[(3S)-1-amino-2-oxoazetidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1-amino-2-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 13132707 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | benzyl N-[(3S)-1-amino-2-oxoazetidin-3-yl]carbamate |
| SMILES | NN1C[C@H](NC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C11H13N3O3/c12-14-6-9(10(14)15)13-11(16)17-7-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,16)/t9-/m0/s1 |
| InChIKey | OGORCUCEEWCRBN-VIFPVBQESA-N |
| XLogP | -0.00 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|