C12H15N2O6P — CID 13366890
methoxy-[2-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl]phosphinic acid (PubChem CID 13366890) has the molecular formula C12H15N2O6P and a molecular weight of 314.23 g/mol. Its IUPAC name is methoxy-[2-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl]phosphinic acid.
| Compound Name | methoxy-[2-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl]phosphinic acid |
|---|---|
| PubChem CID | 13366890 |
| Molecular Formula | C12H15N2O6P |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | methoxy-[2-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl]phosphinic acid |
| SMILES | COP(=O)(O)N1CC(NC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C12H15N2O6P/c1-19-21(17,18)14-7-10(11(14)15)13-12(16)20-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,13,16)(H,17,18) |
| InChIKey | RVDMHJBQWHCQQE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|